C32H59N7O10 — CID 20659055
2-[2-[carboxymethyl-[2-oxo-2-[6-(prop-2-enoylamino)hexylamino]ethyl]amino]ethyl-[2-[2-hydroperoxyethyl-[2-[6-(prop-2-enoylamino)hexylamino]oxyethyl]amino]ethyl]amino]acetic acid (PubChem CID 20659055) has the molecular formula C32H59N7O10 and a molecular weight of 701.86 g/mol. Its IUPAC name is 2-[2-[carboxymethyl-[2-oxo-2-[6-(prop-2-enoylamino)hexylamino]ethyl]amino]ethyl-[2-[2-hydroperoxyethyl-[2-[6-(prop-2-enoylamino)hexylamino]oxyethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[2-[carboxymethyl-[2-oxo-2-[6-(prop-2-enoylamino)hexylamino]ethyl]amino]ethyl-[2-[2-hydroperoxyethyl-[2-[6-(prop-2-enoylamino)hexylamino]oxyethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 20659055 |
| Molecular Formula | C32H59N7O10 |
| Molecular Weight | 701.86 g/mol |
| Exact Mass | 701.43 |
| IUPAC Name | 2-[2-[carboxymethyl-[2-oxo-2-[6-(prop-2-enoylamino)hexylamino]ethyl]amino]ethyl-[2-[2-hydroperoxyethyl-[2-[6-(prop-2-enoylamino)hexylamino]oxyethyl]amino]ethyl]amino]acetic acid |
| SMILES | C=CC(=O)NCCCCCCNOCCN(CCOO)CCN(CCN(CC(=O)O)CC(=O)NCCCCCCNC(=O)C=C)CC(=O)O |
| InChI | InChI=1S/C32H59N7O10/c1-3-28(40)33-13-9-5-6-11-15-35-30(42)25-39(27-32(45)46)20-19-38(26-31(43)44)18-17-37(22-24-49-47)21-23-48-36-16-12-8-7-10-14-34-29(41)4-2/h3-4,36,47H,1-2,5-27H2,(H,33,40)(H,34,41)(H,35,42)(H,43,44)(H,45,46) |
| InChIKey | GCPYOCOCAQRXBZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 222.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.86 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|