C16H28N2O6 — CID 20659269
2-[[3-[2-(diethylamino)ethoxy]-3-oxopropoxy]carbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 20659269) has the molecular formula C16H28N2O6 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-[[3-[2-(diethylamino)ethoxy]-3-oxopropoxy]carbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[3-[2-(diethylamino)ethoxy]-3-oxopropoxy]carbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20659269 |
| Molecular Formula | C16H28N2O6 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2-[[3-[2-(diethylamino)ethoxy]-3-oxopropoxy]carbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCC(=O)OCCN(CC)CC |
| InChI | InChI=1S/C16H28N2O6/c1-5-18(6-2)9-12-22-14(19)7-10-24-16(21)17-8-11-23-15(20)13(3)4/h3,5-12H2,1-2,4H3,(H,17,21) |
| InChIKey | JOOXUKAUCHHIFE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|