About 2-prop-2-enoyloxyethyl 4-[[1-(1-ethoxyethoxy)-1-oxopropan-2-yl]amino]-4-oxobutanoate
2-prop-2-enoyloxyethyl 4-[[1-(1-ethoxyethoxy)-1-oxopropan-2-yl]amino]-4-oxobutanoate (PubChem CID 20659318) has the molecular formula C16H25NO8
and a molecular weight of 359.38 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 4-[[1-(1-ethoxyethoxy)-1-oxopropan-2-yl]amino]-4-oxobutanoate.
Molecular Properties
| Compound Name | 2-prop-2-enoyloxyethyl 4-[[1-(1-ethoxyethoxy)-1-oxopropan-2-yl]amino]-4-oxobutanoate |
| PubChem CID | 20659318 |
| Molecular Formula | C16H25NO8 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 4-[[1-(1-ethoxyethoxy)-1-oxopropan-2-yl]amino]-4-oxobutanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCC(=O)NC(C)C(=O)OC(C)OCC |
| InChI | InChI=1S/C16H25NO8/c1-5-14(19)23-9-10-24-15(20)8-7-13(18)17-11(3)16(21)25-12(4)22-6-2/h5,11-12H,1,6-10H2,2-4H3,(H,17,18) |
| InChIKey | UTKATYRABFUZJD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoyloxyethyl 4-[[1-(1-ethoxyethoxy)-1-oxopropan-2-yl]amino]-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoyloxyethyl 4-[[1-(1-ethoxyethoxy)-1-oxopropan-2-yl]amino]-4-oxobutanoate?
The IUPAC name of 2-prop-2-enoyloxyethyl 4-[[1-(1-ethoxyethoxy)-1-oxopropan-2-yl]amino]-4-oxobutanoate (CID 20659318) is 2-prop-2-enoyloxyethyl 4-[[1-(1-ethoxyethoxy)-1-oxopropan-2-yl]amino]-4-oxobutanoate.
What is the SMILES notation for 2-prop-2-enoyloxyethyl 4-[[1-(1-ethoxyethoxy)-1-oxopropan-2-yl]amino]-4-oxobutanoate?
The canonical SMILES for 2-prop-2-enoyloxyethyl 4-[[1-(1-ethoxyethoxy)-1-oxopropan-2-yl]amino]-4-oxobutanoate is C=CC(=O)OCCOC(=O)CCC(=O)NC(C)C(=O)OC(C)OCC.
What is the InChIKey of 2-prop-2-enoyloxyethyl 4-[[1-(1-ethoxyethoxy)-1-oxopropan-2-yl]amino]-4-oxobutanoate?
The InChIKey is UTKATYRABFUZJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO8/c1-5-14(19)23-9-10-24-15(20)8-7-13(18)17-11(3)16(21)25-12(4)22-6-2/h5,11-12H,1,6-10H2,2-4H3,(H,17,18).
What are the key properties of 2-prop-2-enoyloxyethyl 4-[[1-(1-ethoxyethoxy)-1-oxopropan-2-yl]amino]-4-oxobutanoate?
2-prop-2-enoyloxyethyl 4-[[1-(1-ethoxyethoxy)-1-oxopropan-2-yl]amino]-4-oxobutanoate has a molecular weight of 359.38 g/mol, XLogP of 0.47, 12 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoyloxyethyl 4-[[1-(1-ethoxyethoxy)-1-oxopropan-2-yl]amino]-4-oxobutanoate is sourced from PubChem (CID 20659318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).