About 2-prop-2-enoyloxyethyl 4-[[2-(1-ethoxyethoxy)-2-oxoethyl]amino]-4-oxobutanoate
2-prop-2-enoyloxyethyl 4-[[2-(1-ethoxyethoxy)-2-oxoethyl]amino]-4-oxobutanoate (PubChem CID 20659319) has the molecular formula C15H23NO8
and a molecular weight of 345.35 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 4-[[2-(1-ethoxyethoxy)-2-oxoethyl]amino]-4-oxobutanoate.
Molecular Properties
| Compound Name | 2-prop-2-enoyloxyethyl 4-[[2-(1-ethoxyethoxy)-2-oxoethyl]amino]-4-oxobutanoate |
| PubChem CID | 20659319 |
| Molecular Formula | C15H23NO8 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 4-[[2-(1-ethoxyethoxy)-2-oxoethyl]amino]-4-oxobutanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCC(=O)NCC(=O)OC(C)OCC |
| InChI | InChI=1S/C15H23NO8/c1-4-13(18)22-8-9-23-14(19)7-6-12(17)16-10-15(20)24-11(3)21-5-2/h4,11H,1,5-10H2,2-3H3,(H,16,17) |
| InChIKey | ZTLMEZOOAOXYGX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoyloxyethyl 4-[[2-(1-ethoxyethoxy)-2-oxoethyl]amino]-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoyloxyethyl 4-[[2-(1-ethoxyethoxy)-2-oxoethyl]amino]-4-oxobutanoate?
The IUPAC name of 2-prop-2-enoyloxyethyl 4-[[2-(1-ethoxyethoxy)-2-oxoethyl]amino]-4-oxobutanoate (CID 20659319) is 2-prop-2-enoyloxyethyl 4-[[2-(1-ethoxyethoxy)-2-oxoethyl]amino]-4-oxobutanoate.
What is the SMILES notation for 2-prop-2-enoyloxyethyl 4-[[2-(1-ethoxyethoxy)-2-oxoethyl]amino]-4-oxobutanoate?
The canonical SMILES for 2-prop-2-enoyloxyethyl 4-[[2-(1-ethoxyethoxy)-2-oxoethyl]amino]-4-oxobutanoate is C=CC(=O)OCCOC(=O)CCC(=O)NCC(=O)OC(C)OCC.
What is the InChIKey of 2-prop-2-enoyloxyethyl 4-[[2-(1-ethoxyethoxy)-2-oxoethyl]amino]-4-oxobutanoate?
The InChIKey is ZTLMEZOOAOXYGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO8/c1-4-13(18)22-8-9-23-14(19)7-6-12(17)16-10-15(20)24-11(3)21-5-2/h4,11H,1,5-10H2,2-3H3,(H,16,17).
What are the key properties of 2-prop-2-enoyloxyethyl 4-[[2-(1-ethoxyethoxy)-2-oxoethyl]amino]-4-oxobutanoate?
2-prop-2-enoyloxyethyl 4-[[2-(1-ethoxyethoxy)-2-oxoethyl]amino]-4-oxobutanoate has a molecular weight of 345.35 g/mol, XLogP of 0.08, 12 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoyloxyethyl 4-[[2-(1-ethoxyethoxy)-2-oxoethyl]amino]-4-oxobutanoate is sourced from PubChem (CID 20659319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).