C13H20O — CID 20659560
1-(2,3,5,6,7,8,9,9a-octahydro-1H-benzo[7]annulen-2-yl)ethanone (PubChem CID 20659560) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 1-(2,3,5,6,7,8,9,9a-octahydro-1H-benzo[7]annulen-2-yl)ethanone.
| Compound Name | 1-(2,3,5,6,7,8,9,9a-octahydro-1H-benzo[7]annulen-2-yl)ethanone |
|---|---|
| PubChem CID | 20659560 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 1-(2,3,5,6,7,8,9,9a-octahydro-1H-benzo[7]annulen-2-yl)ethanone |
| SMILES | CC(=O)C1CC=C2CCCCCC2C1 |
| InChI | InChI=1S/C13H20O/c1-10(14)12-8-7-11-5-3-2-4-6-13(11)9-12/h7,12-13H,2-6,8-9H2,1H3 |
| InChIKey | TZQVUFJPYPOXTL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|