C14H30O — CID 20659783
2,3,6,7,8-pentamethylnonan-3-ol (PubChem CID 20659783) has the molecular formula C14H30O and a molecular weight of 214.39 g/mol. Its IUPAC name is 2,3,6,7,8-pentamethylnonan-3-ol.
| Compound Name | 2,3,6,7,8-pentamethylnonan-3-ol |
|---|---|
| PubChem CID | 20659783 |
| Molecular Formula | C14H30O |
| Molecular Weight | 214.39 g/mol |
| Exact Mass | 214.23 |
| IUPAC Name | 2,3,6,7,8-pentamethylnonan-3-ol |
| SMILES | CC(C)C(C)C(C)CCC(C)(O)C(C)C |
| InChI | InChI=1S/C14H30O/c1-10(2)13(6)12(5)8-9-14(7,15)11(3)4/h10-13,15H,8-9H2,1-7H3 |
| InChIKey | AQWUVKXUQBFXDF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |