C22H27N3O3 — CID 20659877
methyl 4-[[2-amino-5-(azepane-1-carbonyl)anilino]methyl]benzoate (PubChem CID 20659877) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is methyl 4-[[2-amino-5-(azepane-1-carbonyl)anilino]methyl]benzoate.
| Compound Name | methyl 4-[[2-amino-5-(azepane-1-carbonyl)anilino]methyl]benzoate |
|---|---|
| PubChem CID | 20659877 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | methyl 4-[[2-amino-5-(azepane-1-carbonyl)anilino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNc2cc(C(=O)N3CCCCCC3)ccc2N)cc1 |
| InChI | InChI=1S/C22H27N3O3/c1-28-22(27)17-8-6-16(7-9-17)15-24-20-14-18(10-11-19(20)23)21(26)25-12-4-2-3-5-13-25/h6-11,14,24H,2-5,12-13,15,23H2,1H3 |
| InChIKey | HFNFUGQDHVNOAC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|