C8H10O — CID 20660053
2,4-dimethyl-6-methylidenepyran (PubChem CID 20660053) has the molecular formula C8H10O and a molecular weight of 122.17 g/mol. Its IUPAC name is 2,4-dimethyl-6-methylidenepyran.
| Compound Name | 2,4-dimethyl-6-methylidenepyran |
|---|---|
| PubChem CID | 20660053 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 2,4-dimethyl-6-methylidenepyran |
| SMILES | C=C1C=C(C)C=C(C)O1 |
| InChI | InChI=1S/C8H10O/c1-6-4-7(2)9-8(3)5-6/h4-5H,2H2,1,3H3 |
| InChIKey | JWFAQQCOAGPKOK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |