C23H36O4 — CID 20660081
3,5,6,8-tetramethyl-3-(3-methylperoxypropyl)-8-propyl-1,2,9,10-tetrahydropyrano[3,2-f]chromene (PubChem CID 20660081) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is 3,5,6,8-tetramethyl-3-(3-methylperoxypropyl)-8-propyl-1,2,9,10-tetrahydropyrano[3,2-f]chromene.
| Compound Name | 3,5,6,8-tetramethyl-3-(3-methylperoxypropyl)-8-propyl-1,2,9,10-tetrahydropyrano[3,2-f]chromene |
|---|---|
| PubChem CID | 20660081 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 3,5,6,8-tetramethyl-3-(3-methylperoxypropyl)-8-propyl-1,2,9,10-tetrahydropyrano[3,2-f]chromene |
| SMILES | CCCC1(C)CCc2c3c(c(C)c(C)c2O1)OC(C)(CCCOOC)CC3 |
| InChI | InChI=1S/C23H36O4/c1-7-11-22(4)13-9-18-19-10-14-23(5,12-8-15-25-24-6)27-21(19)17(3)16(2)20(18)26-22/h7-15H2,1-6H3 |
| InChIKey | KGCVMRPGMOCNKW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|