About 1-(1,1-dihydroxypropan-2-yl)-1-methylguanidine
1-(1,1-dihydroxypropan-2-yl)-1-methylguanidine (PubChem CID 20660154) has the molecular formula C5H13N3O2
and a molecular weight of 147.18 g/mol. Its IUPAC name is 1-(1,1-dihydroxypropan-2-yl)-1-methylguanidine.
Molecular Properties
| Compound Name | 1-(1,1-dihydroxypropan-2-yl)-1-methylguanidine |
| PubChem CID | 20660154 |
| Molecular Formula | C5H13N3O2 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 1-(1,1-dihydroxypropan-2-yl)-1-methylguanidine |
| SMILES | [H]/N=C(\N)N(C)C(C)C(O)O |
| InChI | InChI=1S/C5H13N3O2/c1-3(4(9)10)8(2)5(6)7/h3-4,9-10H,1-2H3,(H3,6,7) |
| InChIKey | NWNUMGQNFUSKID-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,1-dihydroxypropan-2-yl)-1-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dihydroxypropan-2-yl)-1-methylguanidine?
The IUPAC name of 1-(1,1-dihydroxypropan-2-yl)-1-methylguanidine (CID 20660154) is 1-(1,1-dihydroxypropan-2-yl)-1-methylguanidine.
What is the SMILES notation for 1-(1,1-dihydroxypropan-2-yl)-1-methylguanidine?
The canonical SMILES for 1-(1,1-dihydroxypropan-2-yl)-1-methylguanidine is [H]/N=C(\N)N(C)C(C)C(O)O.
What is the InChIKey of 1-(1,1-dihydroxypropan-2-yl)-1-methylguanidine?
The InChIKey is NWNUMGQNFUSKID-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3O2/c1-3(4(9)10)8(2)5(6)7/h3-4,9-10H,1-2H3,(H3,6,7).
What are the key properties of 1-(1,1-dihydroxypropan-2-yl)-1-methylguanidine?
1-(1,1-dihydroxypropan-2-yl)-1-methylguanidine has a molecular weight of 147.18 g/mol, XLogP of -1.49, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dihydroxypropan-2-yl)-1-methylguanidine is sourced from PubChem (CID 20660154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).