About N-(3-methyl-2,4-dioxopentyl)propanamide
N-(3-methyl-2,4-dioxopentyl)propanamide (PubChem CID 20660440) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is N-(3-methyl-2,4-dioxopentyl)propanamide.
Molecular Properties
| Compound Name | N-(3-methyl-2,4-dioxopentyl)propanamide |
| PubChem CID | 20660440 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | N-(3-methyl-2,4-dioxopentyl)propanamide |
| SMILES | CCC(=O)NCC(=O)C(C)C(C)=O |
| InChI | InChI=1S/C9H15NO3/c1-4-9(13)10-5-8(12)6(2)7(3)11/h6H,4-5H2,1-3H3,(H,10,13) |
| InChIKey | AIPSMGZPVIOWGN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methyl-2,4-dioxopentyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methyl-2,4-dioxopentyl)propanamide?
The IUPAC name of N-(3-methyl-2,4-dioxopentyl)propanamide (CID 20660440) is N-(3-methyl-2,4-dioxopentyl)propanamide.
What is the SMILES notation for N-(3-methyl-2,4-dioxopentyl)propanamide?
The canonical SMILES for N-(3-methyl-2,4-dioxopentyl)propanamide is CCC(=O)NCC(=O)C(C)C(C)=O.
What is the InChIKey of N-(3-methyl-2,4-dioxopentyl)propanamide?
The InChIKey is AIPSMGZPVIOWGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-4-9(13)10-5-8(12)6(2)7(3)11/h6H,4-5H2,1-3H3,(H,10,13).
What are the key properties of N-(3-methyl-2,4-dioxopentyl)propanamide?
N-(3-methyl-2,4-dioxopentyl)propanamide has a molecular weight of 185.22 g/mol, XLogP of 0.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methyl-2,4-dioxopentyl)propanamide is sourced from PubChem (CID 20660440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).