C16H12BrClN2O5 — CID 20660513
2-bromo-N-(2-chloro-5-nitrophenyl)-3-(4-methoxyphenyl)-3-oxopropanamide (PubChem CID 20660513) has the molecular formula C16H12BrClN2O5 and a molecular weight of 427.64 g/mol. Its IUPAC name is 2-bromo-N-(2-chloro-5-nitrophenyl)-3-(4-methoxyphenyl)-3-oxopropanamide.
| Compound Name | 2-bromo-N-(2-chloro-5-nitrophenyl)-3-(4-methoxyphenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 20660513 |
| Molecular Formula | C16H12BrClN2O5 |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 425.96 |
| IUPAC Name | 2-bromo-N-(2-chloro-5-nitrophenyl)-3-(4-methoxyphenyl)-3-oxopropanamide |
| SMILES | COc1ccc(C(=O)C(Br)C(=O)Nc2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C16H12BrClN2O5/c1-25-11-5-2-9(3-6-11)15(21)14(17)16(22)19-13-8-10(20(23)24)4-7-12(13)18/h2-8,14H,1H3,(H,19,22) |
| InChIKey | SSJSJWBUFZYBTN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|