C19H18ClN3O — CID 20660576
4-[5-(4-chlorophenyl)-3-cyclopentyloxy-1H-pyrazol-4-yl]pyridine (PubChem CID 20660576) has the molecular formula C19H18ClN3O and a molecular weight of 339.83 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)-3-cyclopentyloxy-1H-pyrazol-4-yl]pyridine.
| Compound Name | 4-[5-(4-chlorophenyl)-3-cyclopentyloxy-1H-pyrazol-4-yl]pyridine |
|---|---|
| PubChem CID | 20660576 |
| Molecular Formula | C19H18ClN3O |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 4-[5-(4-chlorophenyl)-3-cyclopentyloxy-1H-pyrazol-4-yl]pyridine |
| SMILES | Clc1ccc(-c2[nH]nc(OC3CCCC3)c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C19H18ClN3O/c20-15-7-5-14(6-8-15)18-17(13-9-11-21-12-10-13)19(23-22-18)24-16-3-1-2-4-16/h5-12,16H,1-4H2,(H,22,23) |
| InChIKey | ZBKBYGCEOBMUDQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |