About methyl (1Z)-2,2-dimethyl-N-[2-(4-methylphenyl)anilino]propanimidothioate
methyl (1Z)-2,2-dimethyl-N-[2-(4-methylphenyl)anilino]propanimidothioate (PubChem CID 20661027) has the molecular formula C19H24N2S
and a molecular weight of 312.48 g/mol. Its IUPAC name is methyl (1Z)-2,2-dimethyl-N-[2-(4-methylphenyl)anilino]propanimidothioate.
Molecular Properties
| Compound Name | methyl (1Z)-2,2-dimethyl-N-[2-(4-methylphenyl)anilino]propanimidothioate |
| PubChem CID | 20661027 |
| Molecular Formula | C19H24N2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | methyl (1Z)-2,2-dimethyl-N-[2-(4-methylphenyl)anilino]propanimidothioate |
| SMILES | CS/C(=N\Nc1ccccc1-c1ccc(C)cc1)C(C)(C)C |
| InChI | InChI=1S/C19H24N2S/c1-14-10-12-15(13-11-14)16-8-6-7-9-17(16)20-21-18(22-5)19(2,3)4/h6-13,20H,1-5H3/b21-18- |
| InChIKey | CGVVLBKYNKFJIR-UZYVYHOESA-N |
| XLogP | 5.80 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (1Z)-2,2-dimethyl-N-[2-(4-methylphenyl)anilino]propanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1Z)-2,2-dimethyl-N-[2-(4-methylphenyl)anilino]propanimidothioate?
The IUPAC name of methyl (1Z)-2,2-dimethyl-N-[2-(4-methylphenyl)anilino]propanimidothioate (CID 20661027) is methyl (1Z)-2,2-dimethyl-N-[2-(4-methylphenyl)anilino]propanimidothioate.
What is the SMILES notation for methyl (1Z)-2,2-dimethyl-N-[2-(4-methylphenyl)anilino]propanimidothioate?
The canonical SMILES for methyl (1Z)-2,2-dimethyl-N-[2-(4-methylphenyl)anilino]propanimidothioate is CS/C(=N\Nc1ccccc1-c1ccc(C)cc1)C(C)(C)C.
What is the InChIKey of methyl (1Z)-2,2-dimethyl-N-[2-(4-methylphenyl)anilino]propanimidothioate?
The InChIKey is CGVVLBKYNKFJIR-UZYVYHOESA-N. The full InChI is InChI=1S/C19H24N2S/c1-14-10-12-15(13-11-14)16-8-6-7-9-17(16)20-21-18(22-5)19(2,3)4/h6-13,20H,1-5H3/b21-18-.
What are the key properties of methyl (1Z)-2,2-dimethyl-N-[2-(4-methylphenyl)anilino]propanimidothioate?
methyl (1Z)-2,2-dimethyl-N-[2-(4-methylphenyl)anilino]propanimidothioate has a molecular weight of 312.48 g/mol, XLogP of 5.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1Z)-2,2-dimethyl-N-[2-(4-methylphenyl)anilino]propanimidothioate is sourced from PubChem (CID 20661027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).