About 4-(1-methyl-1,2,4-triazol-3-yl)morpholine
4-(1-methyl-1,2,4-triazol-3-yl)morpholine (PubChem CID 20661091) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is 4-(1-methyl-1,2,4-triazol-3-yl)morpholine.
Molecular Properties
| Compound Name | 4-(1-methyl-1,2,4-triazol-3-yl)morpholine |
| PubChem CID | 20661091 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 4-(1-methyl-1,2,4-triazol-3-yl)morpholine |
| SMILES | Cn1cnc(N2CCOCC2)n1 |
| InChI | InChI=1S/C7H12N4O/c1-10-6-8-7(9-10)11-2-4-12-5-3-11/h6H,2-5H2,1H3 |
| InChIKey | IGMKWKONBMGXSK-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1-methyl-1,2,4-triazol-3-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-methyl-1,2,4-triazol-3-yl)morpholine?
The IUPAC name of 4-(1-methyl-1,2,4-triazol-3-yl)morpholine (CID 20661091) is 4-(1-methyl-1,2,4-triazol-3-yl)morpholine.
What is the SMILES notation for 4-(1-methyl-1,2,4-triazol-3-yl)morpholine?
The canonical SMILES for 4-(1-methyl-1,2,4-triazol-3-yl)morpholine is Cn1cnc(N2CCOCC2)n1.
What is the InChIKey of 4-(1-methyl-1,2,4-triazol-3-yl)morpholine?
The InChIKey is IGMKWKONBMGXSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O/c1-10-6-8-7(9-10)11-2-4-12-5-3-11/h6H,2-5H2,1H3.
What are the key properties of 4-(1-methyl-1,2,4-triazol-3-yl)morpholine?
4-(1-methyl-1,2,4-triazol-3-yl)morpholine has a molecular weight of 168.20 g/mol, XLogP of -0.35, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-methyl-1,2,4-triazol-3-yl)morpholine is sourced from PubChem (CID 20661091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).