C24H36N2O4 — CID 20661105
1-N,2-N-dimethyl-1-N,2-N-bis[5-(oxiran-2-yl)pentyl]benzene-1,2-dicarboxamide (PubChem CID 20661105) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is 1-N,2-N-dimethyl-1-N,2-N-bis[5-(oxiran-2-yl)pentyl]benzene-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-dimethyl-1-N,2-N-bis[5-(oxiran-2-yl)pentyl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 20661105 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 1-N,2-N-dimethyl-1-N,2-N-bis[5-(oxiran-2-yl)pentyl]benzene-1,2-dicarboxamide |
| SMILES | CN(CCCCCC1CO1)C(=O)c1ccccc1C(=O)N(C)CCCCCC1CO1 |
| InChI | InChI=1S/C24H36N2O4/c1-25(15-9-3-5-11-19-17-29-19)23(27)21-13-7-8-14-22(21)24(28)26(2)16-10-4-6-12-20-18-30-20/h7-8,13-14,19-20H,3-6,9-12,15-18H2,1-2H3 |
| InChIKey | ZGAYFDXCUZEPJD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 65.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|