C36H49F3O5 — CID 20661134
[4-[3-oxo-3-(1,1,1-trifluorohexan-2-yloxy)propyl]phenyl] 6-decoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 20661134) has the molecular formula C36H49F3O5 and a molecular weight of 618.78 g/mol. Its IUPAC name is [4-[3-oxo-3-(1,1,1-trifluorohexan-2-yloxy)propyl]phenyl] 6-decoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | [4-[3-oxo-3-(1,1,1-trifluorohexan-2-yloxy)propyl]phenyl] 6-decoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 20661134 |
| Molecular Formula | C36H49F3O5 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.35 |
| IUPAC Name | [4-[3-oxo-3-(1,1,1-trifluorohexan-2-yloxy)propyl]phenyl] 6-decoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCCCCCCCCCOc1ccc2c(c1)CCC(C(=O)Oc1ccc(CCC(=O)OC(CCCC)C(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C36H49F3O5/c1-3-5-7-8-9-10-11-12-24-42-32-22-19-28-25-30(18-17-29(28)26-32)35(41)43-31-20-14-27(15-21-31)16-23-34(40)44-33(13-6-4-2)36(37,38)39/h14-15,19-22,26,30,33H,3-13,16-18,23-25H2,1-2H3 |
| InChIKey | OASPSLXRMHIXDJ-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|