About 1,3-bis(trimethylsilyl)propan-2-yl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)butanoate
1,3-bis(trimethylsilyl)propan-2-yl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)butanoate (PubChem CID 20661382) has the molecular formula C19H36O5Si2
and a molecular weight of 400.66 g/mol. Its IUPAC name is 1,3-bis(trimethylsilyl)propan-2-yl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)butanoate.
Molecular Properties
| Compound Name | 1,3-bis(trimethylsilyl)propan-2-yl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)butanoate |
| PubChem CID | 20661382 |
| Molecular Formula | C19H36O5Si2 |
| Molecular Weight | 400.66 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1,3-bis(trimethylsilyl)propan-2-yl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)butanoate |
| SMILES | CCC(C)(C(=O)OC(C[Si](C)(C)C)C[Si](C)(C)C)C1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C19H36O5Si2/c1-10-19(3,15-13(2)16(20)24-17(15)21)18(22)23-14(11-25(4,5)6)12-26(7,8)9/h13-15H,10-12H2,1-9H3 |
| InChIKey | UFPOFGXQLRAYCV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.66 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(trimethylsilyl)propan-2-yl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(trimethylsilyl)propan-2-yl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)butanoate?
The IUPAC name of 1,3-bis(trimethylsilyl)propan-2-yl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)butanoate (CID 20661382) is 1,3-bis(trimethylsilyl)propan-2-yl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)butanoate.
What is the SMILES notation for 1,3-bis(trimethylsilyl)propan-2-yl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)butanoate?
The canonical SMILES for 1,3-bis(trimethylsilyl)propan-2-yl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)butanoate is CCC(C)(C(=O)OC(C[Si](C)(C)C)C[Si](C)(C)C)C1C(=O)OC(=O)C1C.
What is the InChIKey of 1,3-bis(trimethylsilyl)propan-2-yl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)butanoate?
The InChIKey is UFPOFGXQLRAYCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O5Si2/c1-10-19(3,15-13(2)16(20)24-17(15)21)18(22)23-14(11-25(4,5)6)12-26(7,8)9/h13-15H,10-12H2,1-9H3.
What are the key properties of 1,3-bis(trimethylsilyl)propan-2-yl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)butanoate?
1,3-bis(trimethylsilyl)propan-2-yl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)butanoate has a molecular weight of 400.66 g/mol, XLogP of 4.33, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(trimethylsilyl)propan-2-yl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)butanoate is sourced from PubChem (CID 20661382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).