C24H38O9 — CID 20661435
bis(2-ethenoxyethyl) 5-(2-ethenoxyethylperoxymethyl)-1,3,5-trimethylcyclohexane-1,3-dicarboxylate (PubChem CID 20661435) has the molecular formula C24H38O9 and a molecular weight of 470.56 g/mol. Its IUPAC name is bis(2-ethenoxyethyl) 5-(2-ethenoxyethylperoxymethyl)-1,3,5-trimethylcyclohexane-1,3-dicarboxylate.
| Compound Name | bis(2-ethenoxyethyl) 5-(2-ethenoxyethylperoxymethyl)-1,3,5-trimethylcyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 20661435 |
| Molecular Formula | C24H38O9 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | bis(2-ethenoxyethyl) 5-(2-ethenoxyethylperoxymethyl)-1,3,5-trimethylcyclohexane-1,3-dicarboxylate |
| SMILES | C=COCCOOCC1(C)CC(C)(C(=O)OCCOC=C)CC(C)(C(=O)OCCOC=C)C1 |
| InChI | InChI=1S/C24H38O9/c1-7-27-10-13-30-20(25)23(5)16-22(4,19-33-32-15-12-29-9-3)17-24(6,18-23)21(26)31-14-11-28-8-2/h7-9H,1-3,10-19H2,4-6H3 |
| InChIKey | CWARUUJUJNOKMP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|