C13H17NO3 — CID 20662014
[3-(4,5-dihydro-1,2-oxazol-3-yl)-2,4,5-trimethylphenyl]methanediol (PubChem CID 20662014) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is [3-(4,5-dihydro-1,2-oxazol-3-yl)-2,4,5-trimethylphenyl]methanediol.
| Compound Name | [3-(4,5-dihydro-1,2-oxazol-3-yl)-2,4,5-trimethylphenyl]methanediol |
|---|---|
| PubChem CID | 20662014 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | [3-(4,5-dihydro-1,2-oxazol-3-yl)-2,4,5-trimethylphenyl]methanediol |
| SMILES | Cc1cc(C(O)O)c(C)c(C2=NOCC2)c1C |
| InChI | InChI=1S/C13H17NO3/c1-7-6-10(13(15)16)9(3)12(8(7)2)11-4-5-17-14-11/h6,13,15-16H,4-5H2,1-3H3 |
| InChIKey | WCWCTDMWPLIBJX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|