C10H15NO8 — CID 20662072
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-(5-methyl-1,2-oxazol-3-yl)hexanoic acid (PubChem CID 20662072) has the molecular formula C10H15NO8 and a molecular weight of 277.23 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-(5-methyl-1,2-oxazol-3-yl)hexanoic acid.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-(5-methyl-1,2-oxazol-3-yl)hexanoic acid |
|---|---|
| PubChem CID | 20662072 |
| Molecular Formula | C10H15NO8 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-(5-methyl-1,2-oxazol-3-yl)hexanoic acid |
| SMILES | Cc1cc([C@](O)(C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO)no1 |
| InChI | InChI=1S/C10H15NO8/c1-4-2-6(11-19-4)10(18,9(16)17)8(15)7(14)5(13)3-12/h2,5,7-8,12-15,18H,3H2,1H3,(H,16,17)/t5-,7-,8+,10-/m1/s1 |
| InChIKey | DNTGOULUDRKOPE-PJGXCUNHSA-N |
| XLogP | -2.67 |
| TPSA | 164.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |