C14H23NO8 — CID 20662073
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-(5-pentyl-1,2-oxazol-3-yl)hexanoic acid (PubChem CID 20662073) has the molecular formula C14H23NO8 and a molecular weight of 333.34 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-(5-pentyl-1,2-oxazol-3-yl)hexanoic acid.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-(5-pentyl-1,2-oxazol-3-yl)hexanoic acid |
|---|---|
| PubChem CID | 20662073 |
| Molecular Formula | C14H23NO8 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-(5-pentyl-1,2-oxazol-3-yl)hexanoic acid |
| SMILES | CCCCCc1cc([C@](O)(C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO)no1 |
| InChI | InChI=1S/C14H23NO8/c1-2-3-4-5-8-6-10(15-23-8)14(22,13(20)21)12(19)11(18)9(17)7-16/h6,9,11-12,16-19,22H,2-5,7H2,1H3,(H,20,21)/t9-,11-,12+,14-/m1/s1 |
| InChIKey | LGTQWHHFUFREMG-SGESHTKJSA-N |
| XLogP | -1.25 |
| TPSA | 164.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|