C13H14N2 — CID 20662671
6-methyl-3-[(1E,3E)-penta-1,3-dienyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 20662671) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 6-methyl-3-[(1E,3E)-penta-1,3-dienyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 6-methyl-3-[(1E,3E)-penta-1,3-dienyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 20662671 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 6-methyl-3-[(1E,3E)-penta-1,3-dienyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C/C=C/C=C/c1c[nH]c2nc(C)ccc12 |
| InChI | InChI=1S/C13H14N2/c1-3-4-5-6-11-9-14-13-12(11)8-7-10(2)15-13/h3-9H,1-2H3,(H,14,15)/b4-3+,6-5+ |
| InChIKey | ZGNJOHZVLOZXFD-VNKDHWASSA-N |
| XLogP | 3.46 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|