C27H31N3O2 — CID 20662692
2-cyclopentyl-N-methyl-2-[4-[(2-methyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)methyl]phenyl]acetamide (PubChem CID 20662692) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-cyclopentyl-N-methyl-2-[4-[(2-methyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)methyl]phenyl]acetamide.
| Compound Name | 2-cyclopentyl-N-methyl-2-[4-[(2-methyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 20662692 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-cyclopentyl-N-methyl-2-[4-[(2-methyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)methyl]phenyl]acetamide |
| SMILES | CNC(=O)C(c1ccc(Cn2c3c(c4ccccc42)CCN(C)C3=O)cc1)C1CCCC1 |
| InChI | InChI=1S/C27H31N3O2/c1-28-26(31)24(19-7-3-4-8-19)20-13-11-18(12-14-20)17-30-23-10-6-5-9-21(23)22-15-16-29(2)27(32)25(22)30/h5-6,9-14,19,24H,3-4,7-8,15-17H2,1-2H3,(H,28,31) |
| InChIKey | YBERWRLORZAZMM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|