About 1,2-dimethyl-6,7-dihydroimidazo[4,5-c]pyridin-4-amine
1,2-dimethyl-6,7-dihydroimidazo[4,5-c]pyridin-4-amine (PubChem CID 20662697) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 1,2-dimethyl-6,7-dihydroimidazo[4,5-c]pyridin-4-amine.
Analyze 1,2-dimethyl-6,7-dihydroimidazo[4,5-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-6,7-dihydroimidazo[4,5-c]pyridin-4-amine?
The IUPAC name of 1,2-dimethyl-6,7-dihydroimidazo[4,5-c]pyridin-4-amine (CID 20662697) is 1,2-dimethyl-6,7-dihydroimidazo[4,5-c]pyridin-4-amine.
What is the SMILES notation for 1,2-dimethyl-6,7-dihydroimidazo[4,5-c]pyridin-4-amine?
The canonical SMILES for 1,2-dimethyl-6,7-dihydroimidazo[4,5-c]pyridin-4-amine is Cc1nc2c(n1C)CCN=C2N.
What is the InChIKey of 1,2-dimethyl-6,7-dihydroimidazo[4,5-c]pyridin-4-amine?
The InChIKey is GHQHEMNCBALXSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-5-11-7-6(12(5)2)3-4-10-8(7)9/h3-4H2,1-2H3,(H2,9,10).
What are the key properties of 1,2-dimethyl-6,7-dihydroimidazo[4,5-c]pyridin-4-amine?
1,2-dimethyl-6,7-dihydroimidazo[4,5-c]pyridin-4-amine has a molecular weight of 164.21 g/mol, XLogP of -0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-6,7-dihydroimidazo[4,5-c]pyridin-4-amine is sourced from PubChem (CID 20662697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).