About 1,1-dibromo-3,4-dimethylpent-1-ene
1,1-dibromo-3,4-dimethylpent-1-ene (PubChem CID 20662766) has the molecular formula C7H12Br2
and a molecular weight of 255.98 g/mol. Its IUPAC name is 1,1-dibromo-3,4-dimethylpent-1-ene.
Molecular Properties
| Compound Name | 1,1-dibromo-3,4-dimethylpent-1-ene |
| PubChem CID | 20662766 |
| Molecular Formula | C7H12Br2 |
| Molecular Weight | 255.98 g/mol |
| Exact Mass | 253.93 |
| IUPAC Name | 1,1-dibromo-3,4-dimethylpent-1-ene |
| SMILES | CC(C)C(C)C=C(Br)Br |
| InChI | InChI=1S/C7H12Br2/c1-5(2)6(3)4-7(8)9/h4-6H,1-3H3 |
| InChIKey | LAEMRGCEUPRJDT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.98 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-dibromo-3,4-dimethylpent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibromo-3,4-dimethylpent-1-ene?
The IUPAC name of 1,1-dibromo-3,4-dimethylpent-1-ene (CID 20662766) is 1,1-dibromo-3,4-dimethylpent-1-ene.
What is the SMILES notation for 1,1-dibromo-3,4-dimethylpent-1-ene?
The canonical SMILES for 1,1-dibromo-3,4-dimethylpent-1-ene is CC(C)C(C)C=C(Br)Br.
What is the InChIKey of 1,1-dibromo-3,4-dimethylpent-1-ene?
The InChIKey is LAEMRGCEUPRJDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12Br2/c1-5(2)6(3)4-7(8)9/h4-6H,1-3H3.
What are the key properties of 1,1-dibromo-3,4-dimethylpent-1-ene?
1,1-dibromo-3,4-dimethylpent-1-ene has a molecular weight of 255.98 g/mol, XLogP of 3.91, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibromo-3,4-dimethylpent-1-ene is sourced from PubChem (CID 20662766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).