About 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propane-1,2-diol
3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propane-1,2-diol (PubChem CID 20662894) has the molecular formula C15H15O4P
and a molecular weight of 290.25 g/mol. Its IUPAC name is 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propane-1,2-diol.
Molecular Properties
| Compound Name | 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propane-1,2-diol |
| PubChem CID | 20662894 |
| Molecular Formula | C15H15O4P |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propane-1,2-diol |
| SMILES | O=P1(CC(O)CO)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C15H15O4P/c16-9-11(17)10-20(18)15-8-4-2-6-13(15)12-5-1-3-7-14(12)19-20/h1-8,11,16-17H,9-10H2 |
| InChIKey | JSDODTULBHRATA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propane-1,2-diol?
The IUPAC name of 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propane-1,2-diol (CID 20662894) is 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propane-1,2-diol.
What is the SMILES notation for 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propane-1,2-diol?
The canonical SMILES for 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propane-1,2-diol is O=P1(CC(O)CO)Oc2ccccc2-c2ccccc21.
What is the InChIKey of 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propane-1,2-diol?
The InChIKey is JSDODTULBHRATA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15O4P/c16-9-11(17)10-20(18)15-8-4-2-6-13(15)12-5-1-3-7-14(12)19-20/h1-8,11,16-17H,9-10H2.
What are the key properties of 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propane-1,2-diol?
3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propane-1,2-diol has a molecular weight of 290.25 g/mol, XLogP of 2.00, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propane-1,2-diol is sourced from PubChem (CID 20662894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).