About 2,4-ditert-butyl-6-ethyl-3,5-dimethyloxane
2,4-ditert-butyl-6-ethyl-3,5-dimethyloxane (PubChem CID 20662926) has the molecular formula C17H34O
and a molecular weight of 254.46 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-ethyl-3,5-dimethyloxane.
Molecular Properties
| Compound Name | 2,4-ditert-butyl-6-ethyl-3,5-dimethyloxane |
| PubChem CID | 20662926 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | 2,4-ditert-butyl-6-ethyl-3,5-dimethyloxane |
| SMILES | CCC1OC(C(C)(C)C)C(C)C(C(C)(C)C)C1C |
| InChI | InChI=1S/C17H34O/c1-10-13-11(2)14(16(4,5)6)12(3)15(18-13)17(7,8)9/h11-15H,10H2,1-9H3 |
| InChIKey | JXGSOEHERLJYQW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-ditert-butyl-6-ethyl-3,5-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butyl-6-ethyl-3,5-dimethyloxane?
The IUPAC name of 2,4-ditert-butyl-6-ethyl-3,5-dimethyloxane (CID 20662926) is 2,4-ditert-butyl-6-ethyl-3,5-dimethyloxane.
What is the SMILES notation for 2,4-ditert-butyl-6-ethyl-3,5-dimethyloxane?
The canonical SMILES for 2,4-ditert-butyl-6-ethyl-3,5-dimethyloxane is CCC1OC(C(C)(C)C)C(C)C(C(C)(C)C)C1C.
What is the InChIKey of 2,4-ditert-butyl-6-ethyl-3,5-dimethyloxane?
The InChIKey is JXGSOEHERLJYQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O/c1-10-13-11(2)14(16(4,5)6)12(3)15(18-13)17(7,8)9/h11-15H,10H2,1-9H3.
What are the key properties of 2,4-ditert-butyl-6-ethyl-3,5-dimethyloxane?
2,4-ditert-butyl-6-ethyl-3,5-dimethyloxane has a molecular weight of 254.46 g/mol, XLogP of 5.14, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butyl-6-ethyl-3,5-dimethyloxane is sourced from PubChem (CID 20662926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).