C19H22N2O4S — CID 20662980
[(Z)-[cyano-(4-methylphenyl)methylidene]amino] 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate (PubChem CID 20662980) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is [(Z)-[cyano-(4-methylphenyl)methylidene]amino] 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate.
| Compound Name | [(Z)-[cyano-(4-methylphenyl)methylidene]amino] 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate |
|---|---|
| PubChem CID | 20662980 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [(Z)-[cyano-(4-methylphenyl)methylidene]amino] 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate |
| SMILES | Cc1ccc(/C(C#N)=N/OS(=O)(=O)C2C(=O)C3(C)CCC2C3(C)C)cc1 |
| InChI | InChI=1S/C19H22N2O4S/c1-12-5-7-13(8-6-12)15(11-20)21-25-26(23,24)16-14-9-10-19(4,17(16)22)18(14,2)3/h5-8,14,16H,9-10H2,1-4H3/b21-15+ |
| InChIKey | DNYHBKMAEIOJTL-RCCKNPSSSA-N |
| XLogP | 2.96 |
| TPSA | 96.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|