C20H15F2NO — CID 20663039
1-[2,3-difluoro-4-(3-methylisoquinolin-7-yl)phenyl]but-3-yn-2-ol (PubChem CID 20663039) has the molecular formula C20H15F2NO and a molecular weight of 323.34 g/mol. Its IUPAC name is 1-[2,3-difluoro-4-(3-methylisoquinolin-7-yl)phenyl]but-3-yn-2-ol.
| Compound Name | 1-[2,3-difluoro-4-(3-methylisoquinolin-7-yl)phenyl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 20663039 |
| Molecular Formula | C20H15F2NO |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-[2,3-difluoro-4-(3-methylisoquinolin-7-yl)phenyl]but-3-yn-2-ol |
| SMILES | C#CC(O)Cc1ccc(-c2ccc3cc(C)ncc3c2)c(F)c1F |
| InChI | InChI=1S/C20H15F2NO/c1-3-17(24)10-15-6-7-18(20(22)19(15)21)14-5-4-13-8-12(2)23-11-16(13)9-14/h1,4-9,11,17,24H,10H2,2H3 |
| InChIKey | JVPBKHWNLQZCOH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|