About [2-(2-chlorophenyl)-2-oxoethyl] 2-acetamidobenzoate
[2-(2-chlorophenyl)-2-oxoethyl] 2-acetamidobenzoate (PubChem CID 2066331) has the molecular formula C17H14ClNO4
and a molecular weight of 331.76 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-2-oxoethyl] 2-acetamidobenzoate.
Molecular Properties
| Compound Name | [2-(2-chlorophenyl)-2-oxoethyl] 2-acetamidobenzoate |
| PubChem CID | 2066331 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | [2-(2-chlorophenyl)-2-oxoethyl] 2-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccccc1C(=O)OCC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H14ClNO4/c1-11(20)19-15-9-5-3-7-13(15)17(22)23-10-16(21)12-6-2-4-8-14(12)18/h2-9H,10H2,1H3,(H,19,20) |
| InChIKey | PMUMZPVBMDHUTQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2-chlorophenyl)-2-oxoethyl] 2-acetamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-chlorophenyl)-2-oxoethyl] 2-acetamidobenzoate?
The IUPAC name of [2-(2-chlorophenyl)-2-oxoethyl] 2-acetamidobenzoate (CID 2066331) is [2-(2-chlorophenyl)-2-oxoethyl] 2-acetamidobenzoate.
What is the SMILES notation for [2-(2-chlorophenyl)-2-oxoethyl] 2-acetamidobenzoate?
The canonical SMILES for [2-(2-chlorophenyl)-2-oxoethyl] 2-acetamidobenzoate is CC(=O)Nc1ccccc1C(=O)OCC(=O)c1ccccc1Cl.
What is the InChIKey of [2-(2-chlorophenyl)-2-oxoethyl] 2-acetamidobenzoate?
The InChIKey is PMUMZPVBMDHUTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClNO4/c1-11(20)19-15-9-5-3-7-13(15)17(22)23-10-16(21)12-6-2-4-8-14(12)18/h2-9H,10H2,1H3,(H,19,20).
What are the key properties of [2-(2-chlorophenyl)-2-oxoethyl] 2-acetamidobenzoate?
[2-(2-chlorophenyl)-2-oxoethyl] 2-acetamidobenzoate has a molecular weight of 331.76 g/mol, XLogP of 3.34, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-chlorophenyl)-2-oxoethyl] 2-acetamidobenzoate is sourced from PubChem (CID 2066331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).