About methyl 9-(dimethylamino)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate
methyl 9-(dimethylamino)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate (PubChem CID 20663608) has the molecular formula C31H29NO5
and a molecular weight of 495.58 g/mol. Its IUPAC name is methyl 9-(dimethylamino)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate.
Molecular Properties
| Compound Name | methyl 9-(dimethylamino)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate |
| PubChem CID | 20663608 |
| Molecular Formula | C31H29NO5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | methyl 9-(dimethylamino)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate |
| SMILES | COC(=O)c1cc2ccc(N(C)C)cc2c2c1C=CC(c1ccc(OC)cc1)(c1ccc(OC)cc1)O2 |
| InChI | InChI=1S/C31H29NO5/c1-32(2)23-11-6-20-18-28(30(33)36-5)26-16-17-31(37-29(26)27(20)19-23,21-7-12-24(34-3)13-8-21)22-9-14-25(35-4)15-10-22/h6-19H,1-5H3 |
| InChIKey | VQJBYTOZLOWTTC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 9-(dimethylamino)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-(dimethylamino)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate?
The IUPAC name of methyl 9-(dimethylamino)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate (CID 20663608) is methyl 9-(dimethylamino)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate.
What is the SMILES notation for methyl 9-(dimethylamino)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate?
The canonical SMILES for methyl 9-(dimethylamino)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate is COC(=O)c1cc2ccc(N(C)C)cc2c2c1C=CC(c1ccc(OC)cc1)(c1ccc(OC)cc1)O2.
What is the InChIKey of methyl 9-(dimethylamino)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate?
The InChIKey is VQJBYTOZLOWTTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H29NO5/c1-32(2)23-11-6-20-18-28(30(33)36-5)26-16-17-31(37-29(26)27(20)19-23,21-7-12-24(34-3)13-8-21)22-9-14-25(35-4)15-10-22/h6-19H,1-5H3.
What are the key properties of methyl 9-(dimethylamino)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate?
methyl 9-(dimethylamino)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate has a molecular weight of 495.58 g/mol, XLogP of 6.06, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-(dimethylamino)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate is sourced from PubChem (CID 20663608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).