C27H16F6N2O4 — CID 20663742
5-[1,1,1,3,3,3-hexafluoro-2-[2-(3-methylphenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione (PubChem CID 20663742) has the molecular formula C27H16F6N2O4 and a molecular weight of 546.42 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-[2-(3-methylphenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-(3-methylphenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 20663742 |
| Molecular Formula | C27H16F6N2O4 |
| Molecular Weight | 546.42 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-(3-methylphenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1cccc(N2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)N(C)C5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)c1 |
| InChI | InChI=1S/C27H16F6N2O4/c1-13-4-3-5-16(10-13)35-23(38)18-9-7-15(12-20(18)24(35)39)25(26(28,29)30,27(31,32)33)14-6-8-17-19(11-14)22(37)34(2)21(17)36/h3-12H,1-2H3 |
| InChIKey | RLYJWRQKEDOYCR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.42 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|