About 2-(4,6-diethyl-1,3-dioxan-2-yl)ethylazanium
2-(4,6-diethyl-1,3-dioxan-2-yl)ethylazanium (PubChem CID 20663775) has the molecular formula C10H22NO2+
and a molecular weight of 188.29 g/mol. Its IUPAC name is 2-(4,6-diethyl-1,3-dioxan-2-yl)ethylazanium.
Molecular Properties
| Compound Name | 2-(4,6-diethyl-1,3-dioxan-2-yl)ethylazanium |
| PubChem CID | 20663775 |
| Molecular Formula | C10H22NO2+ |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 2-(4,6-diethyl-1,3-dioxan-2-yl)ethylazanium |
| SMILES | CCC1CC(CC)OC(CC[NH3+])O1 |
| InChI | InChI=1S/C10H21NO2/c1-3-8-7-9(4-2)13-10(12-8)5-6-11/h8-10H,3-7,11H2,1-2H3/p+1 |
| InChIKey | CUTOZSXMVVEKTL-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4,6-diethyl-1,3-dioxan-2-yl)ethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-diethyl-1,3-dioxan-2-yl)ethylazanium?
The IUPAC name of 2-(4,6-diethyl-1,3-dioxan-2-yl)ethylazanium (CID 20663775) is 2-(4,6-diethyl-1,3-dioxan-2-yl)ethylazanium.
What is the SMILES notation for 2-(4,6-diethyl-1,3-dioxan-2-yl)ethylazanium?
The canonical SMILES for 2-(4,6-diethyl-1,3-dioxan-2-yl)ethylazanium is CCC1CC(CC)OC(CC[NH3+])O1.
What is the InChIKey of 2-(4,6-diethyl-1,3-dioxan-2-yl)ethylazanium?
The InChIKey is CUTOZSXMVVEKTL-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H21NO2/c1-3-8-7-9(4-2)13-10(12-8)5-6-11/h8-10H,3-7,11H2,1-2H3/p+1.
What are the key properties of 2-(4,6-diethyl-1,3-dioxan-2-yl)ethylazanium?
2-(4,6-diethyl-1,3-dioxan-2-yl)ethylazanium has a molecular weight of 188.29 g/mol, XLogP of 0.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-diethyl-1,3-dioxan-2-yl)ethylazanium is sourced from PubChem (CID 20663775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).