C45H64O4 — CID 20663784
bis(4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecanyl) 2-ethyl-2,5,5-trimethylhexanedioate (PubChem CID 20663784) has the molecular formula C45H64O4 and a molecular weight of 669.00 g/mol. Its IUPAC name is bis(4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecanyl) 2-ethyl-2,5,5-trimethylhexanedioate.
| Compound Name | bis(4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecanyl) 2-ethyl-2,5,5-trimethylhexanedioate |
|---|---|
| PubChem CID | 20663784 |
| Molecular Formula | C45H64O4 |
| Molecular Weight | 669.00 g/mol |
| Exact Mass | 668.48 |
| IUPAC Name | bis(4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecanyl) 2-ethyl-2,5,5-trimethylhexanedioate |
| SMILES | CCC(C)(CCC(C)(C)C(=O)OC1CC2CC1C1C3CC(C4C5CCC(C5)C34)C21)C(=O)OC1CC2CC1C1C3CC(C4C5CCC(C5)C34)C21 |
| InChI | InChI=1S/C45H64O4/c1-5-45(4,43(47)49-33-17-25-15-27(33)41-31-19-29(39(25)41)35-21-7-9-23(13-21)37(31)35)11-10-44(2,3)42(46)48-32-16-24-14-26(32)40-30-18-28(38(24)40)34-20-6-8-22(12-20)36(30)34/h20-41H,5-19H2,1-4H3 |
| InChIKey | FPHUIAPPYCKHNR-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.00 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|