C44H62O4 — CID 20663785
bis(4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecanyl) 2-ethyl-2,5-dimethylhexanedioate (PubChem CID 20663785) has the molecular formula C44H62O4 and a molecular weight of 654.98 g/mol. Its IUPAC name is bis(4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecanyl) 2-ethyl-2,5-dimethylhexanedioate.
| Compound Name | bis(4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecanyl) 2-ethyl-2,5-dimethylhexanedioate |
|---|---|
| PubChem CID | 20663785 |
| Molecular Formula | C44H62O4 |
| Molecular Weight | 654.98 g/mol |
| Exact Mass | 654.46 |
| IUPAC Name | bis(4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecanyl) 2-ethyl-2,5-dimethylhexanedioate |
| SMILES | CCC(C)(CCC(C)C(=O)OC1CC2CC1C1C3CC(C4C5CCC(C5)C34)C21)C(=O)OC1CC2CC1C1C3CC(C4C5CCC(C5)C34)C21 |
| InChI | InChI=1S/C44H62O4/c1-4-44(3,43(46)48-33-16-25-14-27(33)41-31-18-29(39(25)41)35-21-6-8-23(12-21)37(31)35)10-9-19(2)42(45)47-32-15-24-13-26(32)40-30-17-28(38(24)40)34-20-5-7-22(11-20)36(30)34/h19-41H,4-18H2,1-3H3 |
| InChIKey | JQYALXIMUVLQDR-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.98 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|