C34H34N4O2 — CID 20663838
(4Z)-3-oxo-4-(1,2,2,3-tetramethylperimidin-3-ium-6-ylidene)-2-(1,2,2,3-tetramethylperimidin-6-yl)cyclobuten-1-olate (PubChem CID 20663838) has the molecular formula C34H34N4O2 and a molecular weight of 530.67 g/mol. Its IUPAC name is (4Z)-3-oxo-4-(1,2,2,3-tetramethylperimidin-3-ium-6-ylidene)-2-(1,2,2,3-tetramethylperimidin-6-yl)cyclobuten-1-olate.
| Compound Name | (4Z)-3-oxo-4-(1,2,2,3-tetramethylperimidin-3-ium-6-ylidene)-2-(1,2,2,3-tetramethylperimidin-6-yl)cyclobuten-1-olate |
|---|---|
| PubChem CID | 20663838 |
| Molecular Formula | C34H34N4O2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | (4Z)-3-oxo-4-(1,2,2,3-tetramethylperimidin-3-ium-6-ylidene)-2-(1,2,2,3-tetramethylperimidin-6-yl)cyclobuten-1-olate |
| SMILES | CN1c2cccc3c(C4=C([O-])/C(=c5\ccc6c7c(cccc57)N(C)C(C)(C)[N+]=6C)C4=O)ccc(c23)N(C)C1(C)C |
| InChI | InChI=1S/C34H34N4O2/c1-33(2)35(5)23-13-9-11-19-21(15-17-25(27(19)23)37(33)7)29-31(39)30(32(29)40)22-16-18-26-28-20(22)12-10-14-24(28)36(6)34(3,4)38(26)8/h9-18H,1-8H3 |
| InChIKey | YIPUSQBZSWXORJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|