About 3-propan-2-yl-5-(3,3,3-trifluoropropyl)-1H-pyrazole
3-propan-2-yl-5-(3,3,3-trifluoropropyl)-1H-pyrazole (PubChem CID 20664541) has the molecular formula C9H13F3N2
and a molecular weight of 206.21 g/mol. Its IUPAC name is 3-propan-2-yl-5-(3,3,3-trifluoropropyl)-1H-pyrazole.
Molecular Properties
| Compound Name | 3-propan-2-yl-5-(3,3,3-trifluoropropyl)-1H-pyrazole |
| PubChem CID | 20664541 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 3-propan-2-yl-5-(3,3,3-trifluoropropyl)-1H-pyrazole |
| SMILES | CC(C)c1cc(CCC(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C9H13F3N2/c1-6(2)8-5-7(13-14-8)3-4-9(10,11)12/h5-6H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | NDUOSCKBYWZMBQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-propan-2-yl-5-(3,3,3-trifluoropropyl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-5-(3,3,3-trifluoropropyl)-1H-pyrazole?
The IUPAC name of 3-propan-2-yl-5-(3,3,3-trifluoropropyl)-1H-pyrazole (CID 20664541) is 3-propan-2-yl-5-(3,3,3-trifluoropropyl)-1H-pyrazole.
What is the SMILES notation for 3-propan-2-yl-5-(3,3,3-trifluoropropyl)-1H-pyrazole?
The canonical SMILES for 3-propan-2-yl-5-(3,3,3-trifluoropropyl)-1H-pyrazole is CC(C)c1cc(CCC(F)(F)F)[nH]n1.
What is the InChIKey of 3-propan-2-yl-5-(3,3,3-trifluoropropyl)-1H-pyrazole?
The InChIKey is NDUOSCKBYWZMBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N2/c1-6(2)8-5-7(13-14-8)3-4-9(10,11)12/h5-6H,3-4H2,1-2H3,(H,13,14).
What are the key properties of 3-propan-2-yl-5-(3,3,3-trifluoropropyl)-1H-pyrazole?
3-propan-2-yl-5-(3,3,3-trifluoropropyl)-1H-pyrazole has a molecular weight of 206.21 g/mol, XLogP of 3.03, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-5-(3,3,3-trifluoropropyl)-1H-pyrazole is sourced from PubChem (CID 20664541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).