About 2-ethyl-5-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole
2-ethyl-5-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 20664561) has the molecular formula C9H13N3S
and a molecular weight of 195.29 g/mol. Its IUPAC name is 2-ethyl-5-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole.
Molecular Properties
| Compound Name | 2-ethyl-5-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole |
| PubChem CID | 20664561 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 2-ethyl-5-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | CCc1nn2c(C(C)C)cnc2s1 |
| InChI | InChI=1S/C9H13N3S/c1-4-8-11-12-7(6(2)3)5-10-9(12)13-8/h5-6H,4H2,1-3H3 |
| InChIKey | YFLOBEXZASXXBJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-5-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole?
The IUPAC name of 2-ethyl-5-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole (CID 20664561) is 2-ethyl-5-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole.
What is the SMILES notation for 2-ethyl-5-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole?
The canonical SMILES for 2-ethyl-5-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole is CCc1nn2c(C(C)C)cnc2s1.
What is the InChIKey of 2-ethyl-5-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole?
The InChIKey is YFLOBEXZASXXBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3S/c1-4-8-11-12-7(6(2)3)5-10-9(12)13-8/h5-6H,4H2,1-3H3.
What are the key properties of 2-ethyl-5-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole?
2-ethyl-5-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole has a molecular weight of 195.29 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-propan-2-ylimidazo[2,1-b][1,3,4]thiadiazole is sourced from PubChem (CID 20664561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).