C14H19NO — CID 20664786
(3Z)-3-ethylidene-4,5,6,7-tetramethyl-3a,7a-dihydro-1H-indol-2-one (PubChem CID 20664786) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (3Z)-3-ethylidene-4,5,6,7-tetramethyl-3a,7a-dihydro-1H-indol-2-one.
| Compound Name | (3Z)-3-ethylidene-4,5,6,7-tetramethyl-3a,7a-dihydro-1H-indol-2-one |
|---|---|
| PubChem CID | 20664786 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (3Z)-3-ethylidene-4,5,6,7-tetramethyl-3a,7a-dihydro-1H-indol-2-one |
| SMILES | C/C=C1\C(=O)NC2C(C)=C(C)C(C)=C(C)C12 |
| InChI | InChI=1S/C14H19NO/c1-6-11-12-9(4)7(2)8(3)10(5)13(12)15-14(11)16/h6,12-13H,1-5H3,(H,15,16)/b11-6- |
| InChIKey | HXNAJRPIGUMDHY-WDZFZDKYSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|