C17H30N4O3 — CID 20664926
3-oxo-N,N'-bis(2-pyrrolidin-1-ylethyl)pentanediamide (PubChem CID 20664926) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-oxo-N,N'-bis(2-pyrrolidin-1-ylethyl)pentanediamide.
| Compound Name | 3-oxo-N,N'-bis(2-pyrrolidin-1-ylethyl)pentanediamide |
|---|---|
| PubChem CID | 20664926 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 3-oxo-N,N'-bis(2-pyrrolidin-1-ylethyl)pentanediamide |
| SMILES | O=C(CC(=O)NCCN1CCCC1)CC(=O)NCCN1CCCC1 |
| InChI | InChI=1S/C17H30N4O3/c22-15(13-16(23)18-5-11-20-7-1-2-8-20)14-17(24)19-6-12-21-9-3-4-10-21/h1-14H2,(H,18,23)(H,19,24) |
| InChIKey | QXVWLVWNXXQOTR-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|