About dioxomolybdenum;bis(9-pyridin-2-ylfluoren-9-ol)
dioxomolybdenum;bis(9-pyridin-2-ylfluoren-9-ol) (PubChem CID 20665235) has the molecular formula C36H26MoN2O4
and a molecular weight of 646.55 g/mol. Its IUPAC name is dioxomolybdenum;bis(9-pyridin-2-ylfluoren-9-ol).
Molecular Properties
| Compound Name | dioxomolybdenum;bis(9-pyridin-2-ylfluoren-9-ol) |
| PubChem CID | 20665235 |
| Molecular Formula | C36H26MoN2O4 |
| Molecular Weight | 646.55 g/mol |
| Exact Mass | 648.09 |
| IUPAC Name | dioxomolybdenum;bis(9-pyridin-2-ylfluoren-9-ol) |
| SMILES | O=[Mo]=O.OC1(c2ccccn2)c2ccccc2-c2ccccc21.OC1(c2ccccn2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/2C18H13NO.Mo.2O/c2*20-18(17-11-5-6-12-19-17)15-9-3-1-7-13(15)14-8-2-4-10-16(14)18;;;/h2*1-12,20H;;; |
| InChIKey | XXZQTTIPKFPCNN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 646.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dioxomolybdenum;bis(9-pyridin-2-ylfluoren-9-ol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxomolybdenum;bis(9-pyridin-2-ylfluoren-9-ol)?
The IUPAC name of dioxomolybdenum;bis(9-pyridin-2-ylfluoren-9-ol) (CID 20665235) is dioxomolybdenum;bis(9-pyridin-2-ylfluoren-9-ol).
What is the SMILES notation for dioxomolybdenum;bis(9-pyridin-2-ylfluoren-9-ol)?
The canonical SMILES for dioxomolybdenum;bis(9-pyridin-2-ylfluoren-9-ol) is O=[Mo]=O.OC1(c2ccccn2)c2ccccc2-c2ccccc21.OC1(c2ccccn2)c2ccccc2-c2ccccc21.
What is the InChIKey of dioxomolybdenum;bis(9-pyridin-2-ylfluoren-9-ol)?
The InChIKey is XXZQTTIPKFPCNN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H13NO.Mo.2O/c2*20-18(17-11-5-6-12-19-17)15-9-3-1-7-13(15)14-8-2-4-10-16(14)18;;;/h2*1-12,20H;;;.
What are the key properties of dioxomolybdenum;bis(9-pyridin-2-ylfluoren-9-ol)?
dioxomolybdenum;bis(9-pyridin-2-ylfluoren-9-ol) has a molecular weight of 646.55 g/mol, XLogP of 6.45, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dioxomolybdenum;bis(9-pyridin-2-ylfluoren-9-ol) is sourced from PubChem (CID 20665235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).