C33H38N2NaO7S3+ — CID 20665761
sodium 4-[(2Z)-5,6-dimethyl-2-[(2E)-2-[[1-(3-sulfobutyl)benzo[e][1,3]benzoxazol-1-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonate (PubChem CID 20665761) has the molecular formula C33H38N2NaO7S3+ and a molecular weight of 693.87 g/mol. Its IUPAC name is sodium 4-[(2Z)-5,6-dimethyl-2-[(2E)-2-[[1-(3-sulfobutyl)benzo[e][1,3]benzoxazol-1-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonate.
| Compound Name | sodium 4-[(2Z)-5,6-dimethyl-2-[(2E)-2-[[1-(3-sulfobutyl)benzo[e][1,3]benzoxazol-1-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 20665761 |
| Molecular Formula | C33H38N2NaO7S3+ |
| Molecular Weight | 693.87 g/mol |
| Exact Mass | 693.17 |
| IUPAC Name | sodium 4-[(2Z)-5,6-dimethyl-2-[(2E)-2-[[1-(3-sulfobutyl)benzo[e][1,3]benzoxazol-1-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonate |
| SMILES | CCC(/C=C1\Sc2cc(C)c(C)cc2N1CCCCS(=O)(=O)[O-])=C\c1oc2ccc3ccccc3c2[n+]1CCC(C)S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C33H38N2O7S3.Na/c1-5-25(21-32-34(15-8-9-17-44(36,37)38)28-18-22(2)23(3)19-30(28)43-32)20-31-35(16-14-24(4)45(39,40)41)33-27-11-7-6-10-26(27)12-13-29(33)42-31;/h6-7,10-13,18-21,24H,5,8-9,14-17H2,1-4H3,(H-,36,37,38,39,40,41);/q;+1 |
| InChIKey | PXLJQUUJSAHVCI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.87 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|