C24H30N4O4S — CID 20666014
N-[2-(benzenesulfonamido)propyl]-5-(piperidin-4-ylmethoxy)-1H-indole-2-carboxamide (PubChem CID 20666014) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)propyl]-5-(piperidin-4-ylmethoxy)-1H-indole-2-carboxamide.
| Compound Name | N-[2-(benzenesulfonamido)propyl]-5-(piperidin-4-ylmethoxy)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 20666014 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N-[2-(benzenesulfonamido)propyl]-5-(piperidin-4-ylmethoxy)-1H-indole-2-carboxamide |
| SMILES | CC(CNC(=O)c1cc2cc(OCC3CCNCC3)ccc2[nH]1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H30N4O4S/c1-17(28-33(30,31)21-5-3-2-4-6-21)15-26-24(29)23-14-19-13-20(7-8-22(19)27-23)32-16-18-9-11-25-12-10-18/h2-8,13-14,17-18,25,27-28H,9-12,15-16H2,1H3,(H,26,29) |
| InChIKey | GPJWRYHMJMEUCT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |