C8H16N2 — CID 20666224
N,N-dimethyl-1-(1,2,3,6-tetrahydropyridin-4-yl)methanamine (PubChem CID 20666224) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is N,N-dimethyl-1-(1,2,3,6-tetrahydropyridin-4-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(1,2,3,6-tetrahydropyridin-4-yl)methanamine |
|---|---|
| PubChem CID | 20666224 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | N,N-dimethyl-1-(1,2,3,6-tetrahydropyridin-4-yl)methanamine |
| SMILES | CN(C)CC1=CCNCC1 |
| InChI | InChI=1S/C8H16N2/c1-10(2)7-8-3-5-9-6-4-8/h3,9H,4-7H2,1-2H3 |
| InChIKey | DUNSEHVPPRIVAB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|