C25H27FN2O2S — CID 20666239
3-[(8aR)-1,2,3,5,8,8a-hexahydroindolizin-7-yl]-5-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindole (PubChem CID 20666239) has the molecular formula C25H27FN2O2S and a molecular weight of 438.57 g/mol. Its IUPAC name is 3-[(8aR)-1,2,3,5,8,8a-hexahydroindolizin-7-yl]-5-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindole.
| Compound Name | 3-[(8aR)-1,2,3,5,8,8a-hexahydroindolizin-7-yl]-5-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 20666239 |
| Molecular Formula | C25H27FN2O2S |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 3-[(8aR)-1,2,3,5,8,8a-hexahydroindolizin-7-yl]-5-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindole |
| SMILES | Cc1cc(C)c(S(=O)(=O)n2cc(C3=CCN4CCC[C@@H]4C3)c3cc(F)ccc32)c(C)c1 |
| InChI | InChI=1S/C25H27FN2O2S/c1-16-11-17(2)25(18(3)12-16)31(29,30)28-15-23(22-14-20(26)6-7-24(22)28)19-8-10-27-9-4-5-21(27)13-19/h6-8,11-12,14-15,21H,4-5,9-10,13H2,1-3H3/t21-/m1/s1 |
| InChIKey | SWUQYDHJKUCUKK-OAQYLSRUSA-N |
| XLogP | 5.19 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |