C23H20FN5O4 — CID 20666314
(Z)-1-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-1-[2-[6-(2-ethenylphenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-N-methoxymethanimine (PubChem CID 20666314) has the molecular formula C23H20FN5O4 and a molecular weight of 449.44 g/mol. Its IUPAC name is (Z)-1-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-1-[2-[6-(2-ethenylphenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-N-methoxymethanimine.
| Compound Name | (Z)-1-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-1-[2-[6-(2-ethenylphenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 20666314 |
| Molecular Formula | C23H20FN5O4 |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | (Z)-1-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-1-[2-[6-(2-ethenylphenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-N-methoxymethanimine |
| SMILES | C=Cc1ccccc1Oc1ncnc(Oc2ccccc2/C(=N/OC)C2=NCCON2)c1F |
| InChI | InChI=1S/C23H20FN5O4/c1-3-15-8-4-6-10-17(15)32-22-19(24)23(27-14-26-22)33-18-11-7-5-9-16(18)20(28-30-2)21-25-12-13-31-29-21/h3-11,14H,1,12-13H2,2H3,(H,25,29)/b28-20- |
| InChIKey | FGUOMVKWPLEHCL-RRAHZORUSA-N |
| XLogP | 4.13 |
| TPSA | 99.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|