C11H11N3O — CID 20666403
3,6-dimethyl-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-5-one (PubChem CID 20666403) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 3,6-dimethyl-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-5-one.
| Compound Name | 3,6-dimethyl-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-5-one |
|---|---|
| PubChem CID | 20666403 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 3,6-dimethyl-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-5-one |
| SMILES | Cc1nc2cccc3n2c1C(=O)N(C)C3 |
| InChI | InChI=1S/C11H11N3O/c1-7-10-11(15)13(2)6-8-4-3-5-9(12-7)14(8)10/h3-5H,6H2,1-2H3 |
| InChIKey | XSOCWIGBTDVKLB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |