About CID 20666422
CID 20666422 (PubChem CID 20666422) has the molecular formula C10H14BN4
and a molecular weight of 201.06 g/mol.
Molecular Properties
| Compound Name | CID 20666422 |
| PubChem CID | 20666422 |
| Molecular Formula | C10H14BN4 |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | — |
| SMILES | CN[B]NCc1cccc2nc(C)cn12 |
| InChI | InChI=1S/C10H14BN4/c1-8-7-15-9(6-13-11-12-2)4-3-5-10(15)14-8/h3-5,7,12-13H,6H2,1-2H3 |
| InChIKey | ZRVVBOQPOUHPHW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 41.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 20666422 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20666422?
The IUPAC name of CID 20666422 (CID 20666422) is not available.
What is the SMILES notation for CID 20666422?
The canonical SMILES for CID 20666422 is CN[B]NCc1cccc2nc(C)cn12.
What is the InChIKey of CID 20666422?
The InChIKey is ZRVVBOQPOUHPHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BN4/c1-8-7-15-9(6-13-11-12-2)4-3-5-10(15)14-8/h3-5,7,12-13H,6H2,1-2H3.
What are the key properties of CID 20666422?
CID 20666422 has a molecular weight of 201.06 g/mol, XLogP of 0.49, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20666422 is sourced from PubChem (CID 20666422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).