C14H19N3 — CID 20666593
N'-(2-cyano-3,4,5,6-tetramethylphenyl)-N,N-dimethylmethanimidamide (PubChem CID 20666593) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is N'-(2-cyano-3,4,5,6-tetramethylphenyl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(2-cyano-3,4,5,6-tetramethylphenyl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 20666593 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | N'-(2-cyano-3,4,5,6-tetramethylphenyl)-N,N-dimethylmethanimidamide |
| SMILES | Cc1c(C)c(C)c(/N=C/N(C)C)c(C#N)c1C |
| InChI | InChI=1S/C14H19N3/c1-9-10(2)12(4)14(16-8-17(5)6)13(7-15)11(9)3/h8H,1-6H3/b16-8+ |
| InChIKey | GBYUYYPDRUKKOD-LZYBPNLTSA-N |
| XLogP | 3.01 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|